Introduction:Basic information about CAS 17768-36-4|3-Hydroxyadamantane-1-acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Hydroxyadamantane-1-acetic acid |
|---|
| CAS Number | 17768-36-4 | Molecular Weight | 210.270 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 375.3±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H18O3 | Melting Point | 125-129°C |
|---|
| MSDS | ChineseUSA | Flash Point | 195.0±16.9 °C |
|---|
Names
| Name | 2-(3-hydroxy-1-adamantyl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 375.3±15.0 °C at 760 mmHg |
|---|
| Melting Point | 125-129°C |
|---|
| Molecular Formula | C12H18O3 |
|---|
| Molecular Weight | 210.270 |
|---|
| Flash Point | 195.0±16.9 °C |
|---|
| Exact Mass | 210.125595 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 1.24 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | JFMDWSCOQLUOCZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CC12CC3CC(CC(O)(C3)C1)C2 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | 24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3.0 |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-Hydroxyadamantane-1-acetic acid |
| Tricyclo[3.3.1.1]decane-1-acetic acid, 3-hydroxy- |
| 3-Hydroxyadamantane-1-aceticacid |
| Tricyclo[3.3.1.1]decane-1-acetic acid, 3-hydroxy-, (5R,7S)- |
| 3-carboxymethyl-1-adamantanol |
| 3-Carboxymethyladamantan-1-ol |
| 1-(Carboxymethyl)-3-hydroxyadamantane |
| 3-Hydroxy-1-adamantaneacetic Acid |
| 5-hydroxy-2-adamantyl acetic acid |
| (3-Hydroxyadamantan-1-yl)acetic acid |
| MFCD00167797 |
| [(1r,3s,5R,7S)-3-Hydroxyadamantan-1-yl]acetic acid |