Introduction：Basic information about CAS 3230-39-5|Phenol,4-[[(4-methoxyphenyl)methylene]amino]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenol,4-[[(4-methoxyphenyl)methylene]amino]- |
|---|
| CAS Number | 3230-39-5 | Molecular Weight | 227.25900 |
|---|
| Density | 1.08g/cm3 | Boiling Point | 410.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H13NO2 | Melting Point | 189ºC |
|---|
| MSDS | / | Flash Point | 202ºC |
|---|
Names
| Name | 4-[(4-methoxyphenyl)methylideneamino]phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.08g/cm3 |
|---|
| Boiling Point | 410.5ºC at 760 mmHg |
|---|
| Melting Point | 189ºC |
|---|
| Molecular Formula | C14H13NO2 |
|---|
| Molecular Weight | 227.25900 |
|---|
| Flash Point | 202ºC |
|---|
| Exact Mass | 227.09500 |
|---|
| PSA | 41.82000 |
|---|
| LogP | 3.15140 |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | YONXPYGTYHMKDH-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C=Nc2ccc(O)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2925290090 |
|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Schiff base |
| p-Methoxybenzylidene p-aminophenol |
| N-(p-Anisal)-4-hydroxyaniline |
| 4-(4-METHOXYBENZYLIDENE)-4-HYDROXYANILINE |
| N-(4-Methoxybenzylidene)-4-hydroxyaniline |
| 4-[(4-Methoxybenzylidene)amino]phenol |
| EINECS 221-768-5 |
| N-(p-Anisylidene)-4-hydroxyaniline |
