Introduction：Basic information about CAS 62956-64-3|6-methoxyindan-1-acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-methoxyindan-1-acetic acid |
|---|
| CAS Number | 62956-64-3 | Molecular Weight | 206.23800 |
|---|
| Density | 1.18g/cm3 | Boiling Point | 375.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 147.3ºC |
|---|
Names
| Name | 2-(6-methoxy-2,3-dihydro-1H-inden-1-yl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.18g/cm3 |
|---|
| Boiling Point | 375.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14O3 |
|---|
| Molecular Weight | 206.23800 |
|---|
| Flash Point | 147.3ºC |
|---|
| Exact Mass | 206.09400 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 2.19970 |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | ALAUISTUIQUUFF-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2c(c1)C(CC(=O)O)CC2 |
|---|
Safety Information
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (6-methoxy-2,3-dihydro-1H-inden-1-yl)acetic acid |
| 6-methoxyindan-1-ylacetic acid |
| 6-Methoxyindan-1-acetic acid |
| 2-(6'-methoxy-2',3'-dihydro-1'H-inden-1'-yl)acetic acid |
| 1H-Indene-1-acetic acid,2,3-dihydro-6-methoxy |
| 6-Methoxi-1-indanyl-essigsaeure |
| 6-Methoxyindan-1-essigsaeure |
| (+-)-2,3-dihydro-6-methoxy-1H-indene-1-acetic acid |
| 6-methoxyindan-1-acetyl chloride |
