Introduction：Basic information about CAS 668969-68-4|ethyl 2-(5-bromo-2-fluorophenyl)-2-oxoacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 2-(5-bromo-2-fluorophenyl)-2-oxoacetate |
|---|
| CAS Number | 668969-68-4 | Molecular Weight | 275.07100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H8BrFO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | ethyl 2-(5-bromo-2-fluorophenyl)-2-oxoacetate |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H8BrFO3 |
|---|
| Molecular Weight | 275.07100 |
|---|
| Exact Mass | 273.96400 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.33400 |
|---|
| InChIKey | YMQNEIXEJHZWSB-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(=O)c1cc(Br)ccc1F |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
