Introduction：Basic information about CAS 6934-03-8|3-tert-butyl-2-hydroxy-6-methylbenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-tert-butyl-2-hydroxy-6-methylbenzoic acid |
|---|
| CAS Number | 6934-03-8 | Molecular Weight | 208.25400 |
|---|
| Density | 1.135g/cm3 | Boiling Point | 319.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161.2ºC |
|---|
Names
| Name | 3-tert-butyl-2-hydroxy-6-methylbenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.135g/cm3 |
|---|
| Boiling Point | 319.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16O3 |
|---|
| Molecular Weight | 208.25400 |
|---|
| Flash Point | 161.2ºC |
|---|
| Exact Mass | 208.11000 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 2.69630 |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | JXQCUCDXLSGQNZ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(C)(C)C)c(O)c1C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2918290000 |
|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 6-methyl-3-t-butylsalicylic acid |
| 3-tert-Butyl-6-methylsalycilic acid |
| Salycilic acid,3-tert-butyl-6-methyl |
| salycilic acid |
| 2-Methyl-5-tert-butylsalicylic acid |
| 2,6-CRESOTIC ACID,3-tert-BUTYL |
| 5-tert-butyl-6-hydroxy-2-methyl-benzoic acid |
| 3-tert-butyl-2-hydroxy-6-methyl-benzoic acid |
| 3-tert-butyl-6-methylsalicylic acid |
| 3-tert-Butyl-2-hydroxy-6-methyl-benzoesaeure |
