Introduction：Basic information about CAS 37199-81-8|sodium,oxolane-2,5-dione,2,4,4-trimethylpent-1-ene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | sodium,oxolane-2,5-dione,2,4,4-trimethylpent-1-ene |
|---|
| CAS Number | 37199-81-8 | Molecular Weight | 235.27500 |
|---|
| Density | / | Boiling Point | 101.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H20NaO3+ | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | sodium,oxolane-2,5-dione,2,4,4-trimethylpent-1-ene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 101.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H20NaO3+ |
|---|
| Molecular Weight | 235.27500 |
|---|
| Exact Mass | 235.13100 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.84870 |
|---|
| InChIKey | JHBKNJSZAQSDFP-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)CC(C)(C)C.O=C1CCC(=O)O1.[Na+] |
|---|
Synonyms
| Maleic anhydride,polymer with 2,4,4-trimethylpentene,sodium salt |
| 2,5-furandione,dihydro-,compd. with 2,4,4-trimethyl-1-pentene,sodium salt (1:1:1) |
| 2,5-Furandione,polymer with 2,4,4-trimethylpentene,sodium salt |
| Maleic anhydride 2,4,4-trimethylpentene polymer sodium salt |
