Introduction：Basic information about CAS 62635-54-5|Butanethioamide,N-(2-chlorophenyl)-3,3-dimethyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Butanethioamide,N-(2-chlorophenyl)-3,3-dimethyl- |
|---|
| CAS Number | 62635-54-5 | Molecular Weight | 241.78000 |
|---|
| Density | 1.16g/cm3 | Boiling Point | 309ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16ClNS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 140.7ºC |
|---|
Names
| Name | N-(2-chlorophenyl)-3,3-dimethylbutanethioamide |
|---|
Chemical & Physical Properties
| Density | 1.16g/cm3 |
|---|
| Boiling Point | 309ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16ClNS |
|---|
| Molecular Weight | 241.78000 |
|---|
| Flash Point | 140.7ºC |
|---|
| Exact Mass | 241.06900 |
|---|
| PSA | 51.16000 |
|---|
| LogP | 4.73600 |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | FNCJITWNQRNHPC-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)CC(=S)Nc1ccccc1Cl |
|---|
