Introduction：Basic information about CAS 221360-86-7|4-(5-Oxo-[1,4]diazepan-1-yl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(5-Oxo-[1,4]diazepan-1-yl)benzoic acid |
|---|
| CAS Number | 221360-86-7 | Molecular Weight | 234.25100 |
|---|
| Density | 1.269g/cm3 | Boiling Point | 546.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H14N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 284.4ºC |
|---|
Names
| Name | 4-(5-oxo-1,4-diazepan-1-yl)benzoic acid |
|---|
Chemical & Physical Properties
| Density | 1.269g/cm3 |
|---|
| Boiling Point | 546.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H14N2O3 |
|---|
| Molecular Weight | 234.25100 |
|---|
| Flash Point | 284.4ºC |
|---|
| Exact Mass | 234.10000 |
|---|
| PSA | 73.13000 |
|---|
| LogP | 1.05200 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | LOTKDJYHIHRYIW-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CCN(c2ccc(C(=O)O)cc2)CCN1 |
|---|
