Introduction：Basic information about CAS 220227-84-9|3-(trifluoromethoxy)benzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(trifluoromethoxy)benzenesulfonyl chloride |
|---|
| CAS Number | 220227-84-9 | Molecular Weight | 260.61800 |
|---|
| Density | 1.530 g/mL at 25 °C(lit.) | Boiling Point | 229-230 °C(lit.) |
|---|
| Molecular Formula | C7H4ClF3O3S | Melting Point | / |
|---|
| MSDS | Chinese | Flash Point | >230 °F |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | 3-(trifluoromethoxy)benzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.530 g/mL at 25 °C(lit.) |
|---|
| Boiling Point | 229-230 °C(lit.) |
|---|
| Molecular Formula | C7H4ClF3O3S |
|---|
| Molecular Weight | 260.61800 |
|---|
| Flash Point | >230 °F |
|---|
| Exact Mass | 259.95200 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 3.59350 |
|---|
| Vapour Pressure | 0.0187mmHg at 25°C |
|---|
| Index of Refraction | n20/D 1.4760(lit.) |
|---|
| InChIKey | DODDSXTWDSJCDN-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1cccc(OC(F)(F)F)c1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45-S39-S37-S36 |
|---|
| RIDADR | UN 3265 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 3-trifluoromethoxyphenylsulfonyl chloride |
| MFCD01091016 |
| 3-(Trifluoromethoxy)benzenesulfonyl chloride |
| 3-trifluoromethoxylbenzene-1-sulfonyl chloride |
| 3-(Trifluoromethoxy)benzene-1-sulfonyl chloride |
