Introduction：Basic information about CAS 72143-20-5|Dihydroxy Melphatalan-d8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dihydroxy Melphatalan-d8 |
|---|
| CAS Number | 72143-20-5 | Molecular Weight | 268.30900 |
|---|
| Density | 1.319g/cm3 | Boiling Point | 519.571°C at 760 mmHg |
|---|
| Molecular Formula | C13H20N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 268.027°C |
|---|
Names
| Name | (S)-2-amino-3-(4-(bis(2-hydroxyethyl)amino)phenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.319g/cm3 |
|---|
| Boiling Point | 519.571°C at 760 mmHg |
|---|
| Molecular Formula | C13H20N2O4 |
|---|
| Molecular Weight | 268.30900 |
|---|
| Flash Point | 268.027°C |
|---|
| Exact Mass | 268.14200 |
|---|
| PSA | 107.02000 |
|---|
| LogP | -0.29 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | WHGUXSYETMNGJA-LBPRGKRZSA-N |
|---|
| SMILES | NC(Cc1ccc(N(CCO)CCO)cc1)C(=O)O |
|---|
Synonyms
| Dihydroxy Melphatalan |
| Dihydroxy Melphalan |
| (2S)-2-Amino-3-[4-(Bis(2-Hydroxyethyl)Amino)Phenyl]Propanoic Acid |
| Melphalan Impurity 1 |
