Introduction:Basic information about CAS 691363-42-5|4-(Cyclopentylamino)-3-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(Cyclopentylamino)-3-nitrobenzoic acid |
|---|
| CAS Number | 691363-42-5 | Molecular Weight | 250.251 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 450.8±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H14N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.4±27.3 °C |
|---|
Names
| Name | 4-cyclopentylamino-3-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 450.8±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H14N2O4 |
|---|
| Molecular Weight | 250.251 |
|---|
| Flash Point | 226.4±27.3 °C |
|---|
| Exact Mass | 250.095352 |
|---|
| PSA | 95.15000 |
|---|
| LogP | 3.98 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | CNIQZZBIZUJGQB-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(NC2CCCC2)c([N+](=O)[O-])c1 |
|---|
Synonyms
| 4-(Cyclopentylamino)-3-nitrobenzoic acid |
| 4-cyclopentylamino-3-nitro-benzoic acid |
| 4-Cyclopentylamino-3-nitro-benzoic ; acid |
| Benzoic acid, 4-(cyclopentylamino)-3-nitro- |