Introduction：Basic information about CAS 608141-43-1|(S)-1-(3-Ethoxy-4-Methoxyphenyl)-2-(Methylsulfonyl)ethylaMine N-acetyl-L-leucine sal, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-1-(3-Ethoxy-4-Methoxyphenyl)-2-(Methylsulfonyl)ethylaMine N-acetyl-L-leucine salt |
|---|
| CAS Number | 608141-43-1 | Molecular Weight | 446.558 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C20H34N2O7S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (S)-2-(3-ethoxy-4-methoxyphenyl)-1-(methylsulphonyl)-eth-2-ylamine N-acetyl-L-leucine salt |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C20H34N2O7S |
|---|
| Molecular Weight | 446.558 |
|---|
| Exact Mass | 446.208679 |
|---|
| PSA | 153.40000 |
|---|
| LogP | 3.93210 |
|---|
| InChIKey | KJZXYHPZWRDLAR-JIJBYVMQSA-N |
|---|
| SMILES | CC(=O)NC(CC(C)C)C(=O)O.CCOc1cc(C(N)CS(C)(=O)=O)ccc1OC |
|---|
Synonyms
| (S)-1-(3-ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethanamine N-acetyl-L-leucinate |
| (S)-1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethylamine N-acetyl -L-leucine salt |
| (1S)-1-(3-ethoxy-4-methoxyphenyl)-2-(methanesulfonyl)ethylamine N-acetyl-L-leucine salt |
| L-Leucine, N-acetyl-, compd. with (αS)-3-ethoxy-4-methoxy-α-[(methylsulfonyl)methyl]benzenemethanamine (1:1) |
| (S)-1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethylamine N-acetyl-L-leucine salt |
| (1S)-1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethanaminium (2S)-2-acetamido-4-methylpentanoate |
