Introduction:Basic information about CAS 849333-19-3|Dipyridamole and prednisolone combination, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dipyridamole and prednisolone combination |
|---|
| CAS Number | 849333-19-3 | Molecular Weight | 865.1 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C45H68N8O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Dipyridamole and prednisolone combination |
|---|
Chemical & Physical Properties
| Molecular Formula | C45H68N8O9 |
|---|
| Molecular Weight | 865.1 |
|---|
| InChIKey | KWEDSPWZQTVIPO-WPUDDCNKSA-N |
|---|
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(O)CC2(C)C1CCC2(O)C(=O)CO.OCCN(CCO)c1nc(N2CCCCC2)c2nc(N(CCO)CCO)nc(N3CCCCC3)c2n1 |
|---|