Introduction：Basic information about CAS 326-78-3|3-Fluoro-4-(octyloxy)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Fluoro-4-(octyloxy)benzoic acid |
|---|
| CAS Number | 326-78-3 | Molecular Weight | 268.324 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 381.6±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H21FO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 184.6±22.3 °C |
|---|
Names
| Name | 3-fluoro-4-octoxybenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 381.6±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H21FO3 |
|---|
| Molecular Weight | 268.324 |
|---|
| Flash Point | 184.6±22.3 °C |
|---|
| Exact Mass | 268.147461 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 5.90 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.500 |
|---|
| InChIKey | SQVFTDZEUGEJTQ-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCOc1ccc(C(=O)O)cc1F |
|---|
Safety Information
| Hazard Codes | F |
|---|
| Safety Phrases | 53-45 |
|---|
| RIDADR | UN 1993 3/PG 3 |
|---|
| WGK Germany | 1 |
|---|
| RTECS | QK9275000 |
|---|
| Hazard Class | 2.2 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-Fluoro-4-(octyloxy)benzoic acid |
| 3-Fluoro-4-n-octyloxybenzoic Acid |
| 3-Fluor-4-octyloxy-benzoesaeure |
| 3-fluoranyl-4-octoxy-benzoic acid |
| MFCD00191649 |
| 3-fluoro-4-octyloxy-benzoic acid |
| 4-octyloxy-3-fluorobenzoic acid |
| Benzoic acid, 3-fluoro-4-(octyloxy)- |
