Introduction：Basic information about CAS 60565-88-0|Bis(4-methylphenyl)iodonium hexafluorophosphate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(4-methylphenyl)iodonium hexafluorophosphate |
|---|
| CAS Number | 60565-88-0 | Molecular Weight | 454.13000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H14F6IP | Melting Point | 175-180ºC |
|---|
| MSDS | USA | Flash Point | / |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | bis(4-methylphenyl)iodanium,hexafluorophosphate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 175-180ºC |
|---|
| Molecular Formula | C14H14F6IP |
|---|
| Molecular Weight | 454.13000 |
|---|
| Exact Mass | 453.97800 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 3.81420 |
|---|
| InChIKey | LHLVGWWCRPPKBC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc([I+]c2ccc(C)cc2)cc1.F[P-](F)(F)(F)(F)F |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Hazard Codes | F,T,Xi |
|---|
| Risk Phrases | R11:Highly Flammable. R25:Toxic if swallowed. R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|
| Safety Phrases | S16-S22-S36/37/39-S45 |
|---|
| RIDADR | UN 2926 4.1/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
Synonyms
| P851 |
| Di-p-tolyliodonium hexafluorophosphate |
| EINECS 262-301-5 |
| 4,4'-dimethyldiphenyl iodonium phosphorushexafluoride |
| MFCD06656584 |
| Bis(p-tolyl)iodonium hexafluorophosphate |
| di(4-methylphenyl)iodonium hexafluorophosphate |
| Bis(4-methylphenyl)iodonium hexafluorophosphate |
| ditolyliodonium hexafluorophosphate |
