Introduction：Basic information about CAS 725-05-3|4'-Methoxy-3-biphenylcarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4'-Methoxy-3-biphenylcarboxylic acid |
|---|
| CAS Number | 725-05-3 | Molecular Weight | 228.243 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 424.6±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12O3 | Melting Point | 202-203 °C |
|---|
| MSDS | / | Flash Point | 164.9±20.3 °C |
|---|
Names
| Name | 3-(4-methoxyphenyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 424.6±38.0 °C at 760 mmHg |
|---|
| Melting Point | 202-203 °C |
|---|
| Molecular Formula | C14H12O3 |
|---|
| Molecular Weight | 228.243 |
|---|
| Flash Point | 164.9±20.3 °C |
|---|
| Exact Mass | 228.078644 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 3.65 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | VWDMBLJBLIUXFS-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-c2cccc(C(=O)O)c2)cc1 |
|---|
Safety Information
Synonyms
| [1,1'-Biphenyl]-3-carboxylic acid, 4'-methoxy- |
| 4'-Methoxy-biphenylcarbonsaeure-(3) |
| 4'-Methoxy-[1,1'-Biphenyl]-3-Carboxylicacid |
| 4'-methoxybiphenyl-3-carboxylic acid |
| MFCD03424599 |
| 3-biphenyl-(4'-methoxy)carboxylic acid |
| 4'-Methoxy-diphenyl-carbonsaeure-(3) |
| 3-carboxy-4'-methoxybiphenyl |
| 4'-Methoxy-3-biphenylcarboxylic acid |
| 4'-Methoxy-biphenyl-3-carbonsaeure |
