Introduction：Basic information about CAS 37076-78-1|Adenosine,5'-deoxy-2-fluoro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Adenosine,5'-deoxy-2-fluoro- |
|---|
| CAS Number | 37076-78-1 | Molecular Weight | 269.23200 |
|---|
| Density | 2.02g/cm3 | Boiling Point | 661.8ºC at 760mmHg |
|---|
| Molecular Formula | C10H12FN5O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 354ºC |
|---|
Names
| Name | 2-fluoro-5'-deoxyadenosine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.02g/cm3 |
|---|
| Boiling Point | 661.8ºC at 760mmHg |
|---|
| Molecular Formula | C10H12FN5O3 |
|---|
| Molecular Weight | 269.23200 |
|---|
| Flash Point | 354ºC |
|---|
| Exact Mass | 269.09200 |
|---|
| PSA | 119.31000 |
|---|
| Index of Refraction | 1.838 |
|---|
| InChIKey | JHHDPGPTPONLOU-UHFFFAOYSA-N |
|---|
| SMILES | CC1OC(n2cnc3c(N)nc(F)nc32)C(O)C1O |
|---|
Synonyms
| 5'-Desoxy-2-fluoroadenosin |
| 2-fluoro-5'-deoxy-adenosine |
| 2-Fluor-5'desoxyadenosin |
| 2-Fluoro-5'-deoxyadenosin |
| 5'-Deoxy-2-fluoroadenosine |
