Introduction：Basic information about CAS 2648-47-7|2,2,3,3,4,4,5,5-octafluoropentanal, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2,3,3,4,4,5,5-octafluoropentanal |
|---|
| CAS Number | 2648-47-7 | Molecular Weight | 230.05600 |
|---|
| Density | 1.508g/cm3 | Boiling Point | 86ºC |
|---|
| Molecular Formula | C5H2F8O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 5.6ºC |
|---|
Names
| Name | 2,2,3,3,4,4,5,5-octafluoropentanal |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.508g/cm3 |
|---|
| Boiling Point | 86ºC |
|---|
| Molecular Formula | C5H2F8O |
|---|
| Molecular Weight | 230.05600 |
|---|
| Flash Point | 5.6ºC |
|---|
| Exact Mass | 229.99800 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 2.35630 |
|---|
| Vapour Pressure | 258mmHg at 25°C |
|---|
| Index of Refraction | 1.277 |
|---|
| InChIKey | BQFRALWVZATVGY-UHFFFAOYSA-N |
|---|
| SMILES | O=CC(F)(F)C(F)(F)C(F)(F)C(F)F |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
Synonyms
| 5H-Perfluoropentanal |
| 2,2,3,3,4,4,5,5-octafluoro-pentanal |
| 5-hydrooctafluoropentanal |
| 2,2,3,3,4,4,5,5-octafluorovaleraldehyde |
| 5H-Octafluor-valeraldehyd |
| 1,1,2,2,3,3,4,4-Octafluoropentanal |
| 5H-octafluoro-valeraldehyde |
