Introduction：Basic information about CAS 175203-74-4|4-methoxy-3,5-dinitrobenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-methoxy-3,5-dinitrobenzenesulfonyl chloride |
|---|
| CAS Number | 175203-74-4 | Molecular Weight | 296.64200 |
|---|
| Density | 1.707g/cm3 | Boiling Point | 472.9ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5ClN2O7S | Melting Point | 62-64ºC |
|---|
| MSDS | / | Flash Point | 239.8ºC |
|---|
Names
| Name | 4-methoxy-3,5-dinitrobenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.707g/cm3 |
|---|
| Boiling Point | 472.9ºC at 760 mmHg |
|---|
| Melting Point | 62-64ºC |
|---|
| Molecular Formula | C7H5ClN2O7S |
|---|
| Molecular Weight | 296.64200 |
|---|
| Flash Point | 239.8ºC |
|---|
| Exact Mass | 295.95100 |
|---|
| PSA | 143.39000 |
|---|
| LogP | 3.56630 |
|---|
| Vapour Pressure | 1.17E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | QSJODFKEHYDNRE-UHFFFAOYSA-N |
|---|
| SMILES | COc1c([N+](=O)[O-])cc(S(=O)(=O)Cl)cc1[N+](=O)[O-] |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3261 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| OR3919 |
| 3,5-dinitro-4-methoxybenzenesulphonyl chloride |
| 3,5-Dinitro-4-Methoxybenzene1-Sulfonyl Chloride |
| 4-methoxy-3,5-dinitro-benzenesulfonyl Chloride |
