Introduction：Basic information about CAS 74755-02-5|2-[(4-chlorophenyl)sulfonyl]-2-hydroxyiminoacetonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(4-chlorophenyl)sulfonyl]-2-hydroxyiminoacetonitrile |
|---|
| CAS Number | 74755-02-5 | Molecular Weight | 244.65500 |
|---|
| Density | 1.51g/cm3 | Boiling Point | 436.6ºC at 760 mmHg |
|---|
| Molecular Formula | C8H5ClN2O3S | Melting Point | 150ºC |
|---|
| MSDS | / | Flash Point | 217.8ºC |
|---|
Names
| Name | 2-[(4-chlorophenyl)sulfonyl]-2-hydroxyiminoacetonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.51g/cm3 |
|---|
| Boiling Point | 436.6ºC at 760 mmHg |
|---|
| Melting Point | 150ºC |
|---|
| Molecular Formula | C8H5ClN2O3S |
|---|
| Molecular Weight | 244.65500 |
|---|
| Flash Point | 217.8ºC |
|---|
| Exact Mass | 243.97100 |
|---|
| PSA | 98.90000 |
|---|
| LogP | 2.50578 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | HJVLCJDWUSCNDF-DHZHZOJOSA-N |
|---|
| SMILES | N#CC(=NO)S(=O)(=O)c1ccc(Cl)cc1 |
|---|
Synonyms
| (4-Chlor-benzolsulfonyl)-hydroxyimino-acetonitril |
| (4-chloro-benzenesulfonyl)-hydroxyimino-acetonitrile |
| 2-[(4-chlorophenyl)sulphonyl]-2-hydroxyiminoacetonitrile |
| (4-Chlor-phenylsulfon)-cyanformaldoxim |
| (4-Chlor-phenylsulfon)-oximinoessigsaeure-nitril |
| (4-CHLOROBENZENESULFONYL)CYANOFORMALDOXIME |
