CAS 41556-26-7|Bis(1,2,2,6,6-pentamethyl-4-piperidinyl) sebacate
Introduction:Basic information about CAS 41556-26-7|Bis(1,2,2,6,6-pentamethyl-4-piperidinyl) sebacate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(1,2,2,6,6-pentamethyl-4-piperidinyl) sebacate | ||
|---|---|---|---|
| CAS Number | 41556-26-7 | Molecular Weight | 508.777 |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 501.6±50.0 °C at 760 mmHg |
| Molecular Formula | C30H56N2O4 | Melting Point | 20ºC |
| MSDS | / | Flash Point | 257.1±30.1 °C |
Names
| Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) decanedioate |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 501.6±50.0 °C at 760 mmHg |
| Melting Point | 20ºC |
| Molecular Formula | C30H56N2O4 |
| Molecular Weight | 508.777 |
| Flash Point | 257.1±30.1 °C |
| Exact Mass | 508.424011 |
| PSA | 59.08000 |
| LogP | 7.41 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | RSOILICUEWXSLA-UHFFFAOYSA-N |
| SMILES | CN1C(C)(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
Safety Information
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933399090 |
Customs
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
Synonyms
| Bis(1,2,2,6,6-pentamethyl-4-piperidyl) sebacate |
| MFCD00134706 |
| Decanedioic acid,bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
| Bis(1,2,2,6,6-pentamethylpiperidin-4-yl) decanedioatato(2-) |
| Tinuvin (R) 292 |
| T6NTJ A1 B1 B1 F1 F1 DOV8VO- DT6NTJ A1 B1 B1 F1 F1 |
| Bis(1,2,2,6,6-pentamethyl-4-piperidinyl) decandioate |
| Decanedioic acid, bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
| EINECS 255-437-1 |
| Bis(1,2,2,6,6-pentamethylpiperidin-4-yl) decanedioate |
| Bis(1,2,2,6,6-pentamethylpiperidin-4-yl) sebacate |
| Bis(1,2,2,6,6,-Pentamethyl-4-Piperodinyl)-Sebacate |
| Bis(1,2,2,6,6-pentamethyl-4-piperidinyl) sebacate |
| Decanedioic Acid Bis(1,2,2,6,6-pentamethyl-4-piperidyl) Ester |
| 1,2,2,6,6-pentamethyl-4-piperidyl decanedioate |
| bis(1,2,2,6,6-pentamethyl-4-piperidyl) decanedioate |
| Ultraviolet Absorber UV 292 |
