CAS 603-11-2|3-Nitrophthalic acid
Introduction：Basic information about CAS 603-11-2|3-Nitrophthalic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Nitrophthalic acid | ||
|---|---|---|---|
| CAS Number | 603-11-2 | Molecular Weight | 211.128 |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 441.3±40.0 °C at 760 mmHg |
| Molecular Formula | C8H5NO6 | Melting Point | 210 °C (dec.)(lit.) |
| MSDS | ChineseUSA | Flash Point | 199.4±15.8 °C |
| Symbol | GHS05, GHS07 | Signal Word | Danger |
Names
| Name | 3-Nitrophthalic acid |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.3±40.0 °C at 760 mmHg |
| Melting Point | 210 °C (dec.)(lit.) |
| Molecular Formula | C8H5NO6 |
| Molecular Weight | 211.128 |
| Flash Point | 199.4±15.8 °C |
| Exact Mass | 211.011688 |
| PSA | 120.42000 |
| LogP | 0.67 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.660 |
| InChIKey | KFIRODWJCYBBHY-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O |
| Storage condition | Refrigerator |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | 20 g/L (25 ºC) |
Safety Information
| Symbol | GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/39-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917399090 |
Customs
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
Articles6
More Articles| Four linear Cu(II)3 subunit-based coordination polymers with various inter-subunit connections, spin ground-states and intra-/inter-subunit magnetic couplings. Dalton Trans. 44(7) , 3190-9, (2015) Four new 4-amino-1,2,4-triazole (atr)-based coordination polymers, {[Cu2(atr)(H2O)(μ-OH)2(pa)]·H2O}n (), {[Cu3(atr)2(H2O)2(μ-OH)2(npa)2]·2H2O}n (), {[Cu3(atr)5(dca)(μ-OH)(ClO4)2](ClO4)2}n () and {[Cu3... | |
| Fate of isoxaben in a containerized plant rhizosphere system. Chemosphere 50(9) , 1243-7, (2003) Commercial production of ornamental plants is an important industry in the United States and involves a complex technology that includes the use of herbicides. Isoxaben[N-[3-(1-ethyl-1-methylpropyl)-5... | |
| [Spectroscopy and thermostability of series rare-earth complexes with 3-nitrophthalic acid]. Guang Pu Xue Yu Guang Pu Fen Xi 29(10) , 2773-6, (2009) A series of rare-earth compound RE2L2 (HL)2 (H2O)6 x 2H2O (RE=La, Nd, Eu, Tb, Er, Y) containing 3-nitrophthalic acid (H2L) ligand were synthesized from ethanol-water solution, and characterized and in... |
Synonyms
| MFCD00007138 |
| 3-nitrobenzene-1,2-dicarboxylic acid |
| EINECS 210-030-8 |
| o-nitrophthalic acid |
| 1,2-Benzenedicarboxylic acid, 3-nitro- |
| 3-Nitrophthalic acid |
| mononitrophthalic acid |
| Phthalic acid,3-nitro |
| 1,2-Benzenedicarboxylic acid,3-nitro |
| 3-nitronaphthalic acid |
| 3-nitro-phthalic acid |
| 3-nitro-1,2-benzenedicarboxylic acid |
