Introduction：Basic information about CAS 101278-21-1|dl-2,3-diphenyl-succinic acid anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dl-2,3-diphenyl-succinic acid anhydride |
|---|
| CAS Number | 101278-21-1 | Molecular Weight | 252.26500 |
|---|
| Density | 1.254g/cm3 | Boiling Point | 431.3ºC at 760mmHg |
|---|
| Molecular Formula | C16H12O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 210.8ºC |
|---|
Names
| Name | dl-2,3-diphenyl-succinic acid anhydride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.254g/cm3 |
|---|
| Boiling Point | 431.3ºC at 760mmHg |
|---|
| Molecular Formula | C16H12O3 |
|---|
| Molecular Weight | 252.26500 |
|---|
| Flash Point | 210.8ºC |
|---|
| Exact Mass | 252.07900 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.63740 |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | UWDJRACNZVFLEC-ZIAGYGMSSA-N |
|---|
| SMILES | O=C1OC(=O)C(c2ccccc2)C1c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| dihydro-3,4-diphenylfuran-2,5-dione |
| 2,3-diphenyl-succinic acid anhydride |
| 6-carboxylic acid-2,3-diphenylquinoxaline |
| 2,3-diphenyl-quinoxaline-6-carboxylic acid |
| 2,3-diphenyl-6-quinoxalinecarboxylic acid |
| 6-Quinoxalinecarboxylic acid,2,3-diphenyl |
| 2,3-Diphenyl-bernsteinsaeure-anhydrid |
| 2,3-Diphenyl-chinoxalin-6-carbonsaeure |
