Introduction：Basic information about CAS 88-90-4|2,6-dinitro-p-toluenesulphonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-dinitro-p-toluenesulphonic acid |
|---|
| CAS Number | 88-90-4 | Molecular Weight | 262.19700 |
|---|
| Density | 1.723g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H6N2O7S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-methyl-3,5-dinitrobenzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.723g/cm3 |
|---|
| Molecular Formula | C7H6N2O7S |
|---|
| Molecular Weight | 262.19700 |
|---|
| Exact Mass | 261.99000 |
|---|
| PSA | 154.39000 |
|---|
| LogP | 3.18530 |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | SWBCSBNHMVLMKP-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c([N+](=O)[O-])cc(S(=O)(=O)O)cc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 3,5-Dinitro-4-methylbenzenesulfonic acid |
| 2,6-Dinitro-toluol-4-sulfonsaeure |
| 2,6-dinitro-p-toluenesulfonic acid |
| 2,6-Dinitro-p-toluenesulphonic acid |
| EINECS 201-866-4 |
| 2,6-dinitrotoluene-4-sulfonic acid |
| 3,5-Dinitro-p-toluenesulfonic acid |
