Introduction：Basic information about CAS 66840-71-9|dmst, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dmst |
|---|
| CAS Number | 66840-71-9 | Molecular Weight | 214.28500 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 319.7ºC at 760 mmHg |
|---|
| Molecular Formula | C9H14N2O2S | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 2ºC |
|---|
| Symbol |
GHS02, GHS07 | Signal Word | Danger |
|---|
Names
| Name | N,N-dimethyl-N'-p-tolylsulfamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 319.7ºC at 760 mmHg |
|---|
| Molecular Formula | C9H14N2O2S |
|---|
| Molecular Weight | 214.28500 |
|---|
| Flash Point | 2ºC |
|---|
| Exact Mass | 214.07800 |
|---|
| PSA | 57.79000 |
|---|
| LogP | 2.36710 |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | UDCDOJQOXWCCSD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(NS(=O)(=O)N(C)C)cc1 |
|---|
Safety Information
| Symbol |
GHS02, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H225-H302-H312-H319-H332 |
|---|
| Precautionary Statements | P210-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | F,T,Xn |
|---|
| Risk Phrases | 11-23/24/25-39/23/24/25-36-20/21/22 |
|---|
| Safety Phrases | 36/37-45-16 |
|---|
| RIDADR | UN 1230 3/PG 2 |
|---|
Synonyms
| N,N-Dimethyl-N'-p-tolylsulphamide |
| DMST solution |
| N,N-Dimethyl-N'-p-tolyl-sulfamid |
| N,N-Dimethyl-N'-tolylsulfonyldiamide |
| N,N-dimethyl-N'-p-tolyl-sulfamide |
| 1-(dimethylsulfamoylamino)-4-methylbenzene |
| N,N-Dimethyl-N'-p-tolyl-schwefelsaeurediamid |
