Introduction：Basic information about CAS 32388-55-9|Acetyl cedrene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetyl cedrene |
|---|
| CAS Number | 32388-55-9 | Molecular Weight | 246.39 |
|---|
| Density | 0.997 g/mL at 25 °C(lit.) | Boiling Point | 272 °C(lit.) |
|---|
| Molecular Formula | C17H26O | Melting Point | / |
|---|
| MSDS | / | Flash Point | >110 ºC |
|---|
Names
| Name | 1-cedr-8-en-9-ylethanone |
|---|
| Synonym | More Synonyms |
|---|
Acetyl cedrene BiologicalActivity
| Description | Methyl Cedryl Ketone is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|
| Related Catalog | Research Areas >>Others |
|---|
Chemical & Physical Properties
| Density | 0.997 g/mL at 25 °C(lit.) |
|---|
| Boiling Point | 272 °C(lit.) |
|---|
| Molecular Formula | C17H26O |
|---|
| Molecular Weight | 246.39 |
|---|
| Flash Point | >110 ºC |
|---|
| Exact Mass | 246.198364 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 5.34 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | n20/D 1.516(lit.) |
|---|
| InChIKey | YBUIAJZFOGJGLJ-SWRJLBSHSA-N |
|---|
| SMILES | CC(=O)C1=C(C)C2CC3(C1)C(C)CCC3C2(C)C |
|---|
Safety Information
| Hazard Codes | F+ |
|---|
| WGK Germany | 2 |
|---|
Synonyms
| Ethanone, 1-[(3R,3aS,6R,7R,8aS)-octahydro-3,6,8,8-tetramethyl-1H-3a,7-methanoazulen-3-yl]- |
| MFCD03410252 |
| Acetylcedrene |
| Methyl Cedryl Ketone |
| Ethanone, 1-[(3R,3aR,7R,8aS)-2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-1H-3a,7-methanoazulen-5-yl]- |
| EINECS 251-020-3 |
| cedar ketone |
| 1-(Cedr-8-en-9-yl)ethanone |
| 1-[(1S,2R,5S,7R,8R)-2,6,6,8-Tetramethyltricyclo[5.3.1.0]undec-2-yl]ethanone |
| Vertofix |
| Lixetone |
| 1-cedr-8-en-9-ylethanone |
| Cedryl methyl ketone |
| 9-acetylcedrene |
| Acetyl cedrene |
| Cedarwood, acetylated |
| 9-Acetyl-8-cedrene |
| DSSTox_CID_9353 |
| Vertofix Coeur |
