Introduction:Basic information about CAS 283160-20-3|Fmoc-β-HomoAsn(Trt)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-β-HomoAsn(Trt)-OH |
|---|
| CAS Number | 283160-20-3 | Molecular Weight | 610.698 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 873.4±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C39H34N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 482.0±34.3 °C |
|---|
Names
| Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 873.4±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C39H34N2O5 |
|---|
| Molecular Weight | 610.698 |
|---|
| Flash Point | 482.0±34.3 °C |
|---|
| Exact Mass | 610.246765 |
|---|
| PSA | 104.73000 |
|---|
| LogP | 8.04 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.636 |
|---|
| InChIKey | AOQYYASFUBPOHJ-PMERELPUSA-N |
|---|
| SMILES | O=C(O)CC(CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Synonyms
| MFCD03427579 |
| Fmoc-beta-Hoasn(Trt)-OH |
| (3S)-3-(9H-Fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-[tri(phenyl)methylamino]pentanoic acid |
| Boc--HoAsp(OBzl)-OH |
| Fmoc--HoAsn(Trt)-OH |
| Fmoc-β-Gln(Trt)-OH |
| AmbotzFAA6640 |
| Pentanoic acid, 3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-5-oxo-5-[(triphenylmethyl)amino]-, (3S)- |
| Nbeta-Fmoc-Ndelta-trityl-L-homoasparagine |
| (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-oxo-5-(tritylamino)pentanoic acid |
| (S)-3-(Fmoc-amino)-N-trityl-valeric acid 5-amide |
| Fmoc-β-homo-Asn(Trt)-OH |
| Fmoc-β-HomoAsn(Trt)-OH |