Introduction：Basic information about CAS 500789-06-0|DL-N-Boc-β-(3-Chlorophenyl)-alanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | DL-N-Boc-β-(3-Chlorophenyl)-alanine |
|---|
| CAS Number | 500789-06-0 | Molecular Weight | 299.750 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 414.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18ClNO4 | Melting Point | 90-92℃ |
|---|
| MSDS | / | Flash Point | 204.3±28.7 °C |
|---|
Names
| Name | (R)-3-((tert-Butoxycarbonyl)amino)-3-(3-chlorophenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 414.1±45.0 °C at 760 mmHg |
|---|
| Melting Point | 90-92℃ |
|---|
| Molecular Formula | C14H18ClNO4 |
|---|
| Molecular Weight | 299.750 |
|---|
| Flash Point | 204.3±28.7 °C |
|---|
| Exact Mass | 299.092438 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 3.44 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | UDUKZORPLJUWTF-LLVKDONJSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)c1cccc(Cl)c1 |
|---|
Synonyms
| L-Aspartic acid, 2-(3-chlorophenyl)-, 1-(1,1-dimethylethyl) ester |
| (3R)-3-Amino-3-(3-chlorophenyl)-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid |
| DL-N-Boc-β-(3-Chlorophenyl)-alanine |
| 3-[(tert-Butoxycarbonyl)amino]-3-(3-chlorophenyl)propanoic acid |
| 3-(3-Chlorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| (3R)-3-(3-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| Benzenepropanoic acid, 3-chloro-β-[[(1,1-dimethylethoxy)carbonyl]amino]- |
