Introduction:Basic information about CAS 41276-30-6|Ethyl 1-benzyl-4-oxonipecotate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 1-benzyl-4-oxonipecotate |
|---|
| CAS Number | 41276-30-6 | Molecular Weight | 261.316 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 379.7±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H19NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 183.4±27.9 °C |
|---|
Names
| Name | ethyl 1-benzyl-4-oxopiperidine-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 379.7±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H19NO3 |
|---|
| Molecular Weight | 261.316 |
|---|
| Flash Point | 183.4±27.9 °C |
|---|
| Exact Mass | 261.136505 |
|---|
| PSA | 46.61000 |
|---|
| LogP | 1.85 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | ROSZJQBQGFBFSW-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C1CN(Cc2ccccc2)CCC1=O |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 23-26-37 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-Benzyl-4-oxonipecotic acid, ethyl ester |
| ethyl1-benzyl-4-oxopiperidine-3-carboxylate |
| T6N DVTJ A1R& CVO2 |
| Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate |
| Ethyl 1-benzyl-4-oxonipecotate |
| ethyl 1-benzyl-4-oxopiperidine-3-carboxylate |
| 1-Benzyl-3-carboethoxy-4-piperidone |
| 1-Benzyl-3-carbethoxy-4-piperidone |
| Ethyl 1-benzyl-4-oxopiperidine-3-carboxylate(HCl Form) |
| ethyl 4-oxo-1-benzylpiperidine-3-carboxylate |
| 3-Piperidinecarboxylic acid, 4-oxo-1-(phenylmethyl)-, ethyl ester |
| 1-Benzyl-3-ethoxycarbonyl-4-piperidone |
| ethyl (1-benzyl-4-oxo-3-piperidine)carboxylate |
| ethyl N-benzyl-4-oxo--3-piperidinecarboxylate |
| ethyl-N-benzyl-4-oxo-piperidinecarboxylate |
| Ethyl 4-oxo-1-(phenylmethyl)-3-piperidinecarboxylate |