CAS 2795-39-3|Potassium heptadecafluoro-1-octanesulfonate
Introduction：Basic information about CAS 2795-39-3|Potassium heptadecafluoro-1-octanesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Potassium heptadecafluoro-1-octanesulfonate | ||
|---|---|---|---|
| CAS Number | 2795-39-3 | Molecular Weight | 538.220 |
| Density | 1.1 | Boiling Point | / |
| Molecular Formula | C8F17KO3S | Melting Point | 277-280 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | / |
| Symbol | GHS07, GHS08, GHS09 | Signal Word | Danger |
Names
| Name | potassium,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.1 |
|---|---|
| Melting Point | 277-280 °C(lit.) |
| Molecular Formula | C8F17KO3S |
| Molecular Weight | 538.220 |
| Exact Mass | 537.893372 |
| PSA | 65.58000 |
| LogP | 5.57930 |
| InChIKey | WFRUBUQWJYMMRQ-UHFFFAOYSA-M |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[K+] |
Safety Information
| Symbol | GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H332-H351-H360-H362-H372-H411 |
| Precautionary Statements | P201-P263-P273-P281-P308 + P313 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26-S61 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | RG9701850 |
| HS Code | 2942000000 |
Customs
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
Articles2
More Articles| PFOS induces behavioral alterations, including spontaneous hyperactivity that is corrected by dexamfetamine in zebrafish larvae. PLoS ONE 9(4) , e94227, (2014) Perfluorooctane sulfonate (PFOS) is a widely spread environmental contaminant. It accumulates in the brain and has potential neurotoxic effects. The exposure to PFOS has been associated with higher im... | |
| Chronic exposure to perfluorooctane sulfonate induces behavior defects and neurotoxicity through oxidative damages, in vivo and in vitro. PLoS ONE 9(11) , e113453, (2014) Perfluorooctane sulfonate (PFOS) is an emerging persistent pollutant which shows multiple adverse health effects. However, the neurotoxicity of PFOS and its mechanisms have not been fully elucidated. ... |
Synonyms
| Perfluorooctanesulfonic acid potassium salt,Potassium heptadecafluoro-1-octanesulfonate |
| heptadecafluooctane sulfonic acid potassium |
| Potassium heptadecafluorooctane-1-sulfonate |
| Potassium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-1-octanesulfonate |
| Perfluorooctanesulfonic Acid Potassium Salt |
| Potassium Perfluoro-1-octanesulfonate |
| EINECS 220-527-1 |
| Fluorad FC 95 |
| Potassium heptadecafluoro-1-octanesulfonate |
| Potassium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| Potassium perfluorooctanesulfonate |
| Perfluoro-1-octanesulfonic Acid Potassium Salt |
| 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluorooctane-1-sulfonic acid,potassium salt |
| Heptadecafluorooctanesulfonic acid potassium salte |
| Floral FC 95 |
| 1-Octanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-, potassium salt (1:1) |
| MFCD00066407 |
| Heptadecafluoro-1-octanesulfonic Acid Potassium Salt |
| Potassium PFOS |
| Potassium perfluorooctylsulfonate |
| EINECS 220-528-7 |
| Heptadecafluorooctanesulfonic acid potassium salt |
| Potassium perfluorooctylsulfonate |
| FC-95 |
