Introduction：Basic information about CAS 230299-21-5|Bis(hexylene glycolato)diboron, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(hexylene glycolato)diboron |
|---|
| CAS Number | 230299-21-5 | Molecular Weight | 253.939 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 242.8±7.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H24B2O4 | Melting Point | 98-102 °C(lit.) |
|---|
| MSDS | / | Flash Point | 100.7±18.2 °C |
|---|
Names
| Name | 4,4,6-trimethyl-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)-1,3,2-dioxaborinane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 242.8±7.0 °C at 760 mmHg |
|---|
| Melting Point | 98-102 °C(lit.) |
|---|
| Molecular Formula | C12H24B2O4 |
|---|
| Molecular Weight | 253.939 |
|---|
| Flash Point | 100.7±18.2 °C |
|---|
| Exact Mass | 254.186066 |
|---|
| PSA | 36.92000 |
|---|
| LogP | 2.24920 |
|---|
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.431 |
|---|
| InChIKey | UEBSWKNVDRJVHN-UHFFFAOYSA-N |
|---|
| SMILES | CC1CC(C)(C)OB(B2OC(C)CC(C)(C)O2)O1 |
|---|
| Storage condition | Refrigerator (+4°C) |
|---|
| Water Solubility | Insoluble |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S37/39-S26 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 2,2'-Bi-1,3,2-dioxaborinane, 4,4,4',4',6,6'-hexamethyl- |
| Bis(2-methyl-2,4-pentanediolato)diboron |
| bis(hexylen glycolato)diboron |
| 4,4,4',4',6,6'-Hexamethyl-2,2'-bi(1,3,2-dioxaborinane) |
| B2(OCMe2CH2CH(Me)O)2 |
| MFCD06246008 |
| 4,4,4',4',6,6'-Hexamethyl-2,2'-bi-1,3,2-dioxaborinane |
| Bis(hexylene glycolato)diboron |
