Introduction：Basic information about CAS 106700-29-2|pethoxamid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | pethoxamid |
|---|
| CAS Number | 106700-29-2 | Molecular Weight | 295.804 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 425.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H22ClNO2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 211.3±27.3 °C |
|---|
| Symbol |
GHS07, GHS09 | Signal Word | Warning |
|---|
Names
| Name | pethoxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 425.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H22ClNO2 |
|---|
| Molecular Weight | 295.804 |
|---|
| Flash Point | 211.3±27.3 °C |
|---|
| Exact Mass | 295.133911 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 2.70 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.527 |
|---|
| InChIKey | CSWIKHNSBZVWNQ-UHFFFAOYSA-N |
|---|
| SMILES | CCOCCN(C(=O)CCl)C(=C(C)C)c1ccccc1 |
|---|
Safety Information
| Symbol |
GHS07, GHS09 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H317-H410 |
|---|
| Precautionary Statements | P273-P280-P301 + P312 + P330-P333 + P313-P391-P501 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn,N |
|---|
| Risk Phrases | 22-43-50/53 |
|---|
| Safety Phrases | 24-37-46-60-61 |
|---|
| RIDADR | UN 3077 9 / PGIII |
|---|
| HS Code | 2924299020 |
|---|
Customs
| HS Code | 2924299020 |
|---|
| Summary | 2924299020 2-chloro-n-(2-ethoxyethyl)-n-(2-methyl-1-phenylprop-1-en-1-yl)acetamide。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:30.0% |
|---|
Synonyms
| 4873772 |
| G1VN2O2&YR&UY1&1 |
| Pethoxamid [ISO] |
| 2-Chloro-N-(2-ethoxyethyl)-N-(2-methyl-1-phenyl-1-propenyl)acetamide |
| 2-Chloro-N-(2-ethoxyethyl)-N-(2-methyl-1-phenylprop-1-en-1-yl)acetamide |
| 2-chloro-N-(2-ethoxyethyl)-N-(2-methyl-1-phenylpropen-1-yl)acetamide |
| 2-Chloro-N-(2-ethoxyethyl)-N-(2-methyl-1-phenyl-1-propen-1-yl)acetamide |
| 2-chloro-N-(2-ethoxy-ethyl)-N-(2-methyl-1-phenyl-1-propenyl)-acetamide |
| Acetamide, 2-chloro-N-(2-ethoxyethyl)-N-(2-methyl-1-phenyl-1-propen-1-yl)- |
| pethoxamid |
| 2-Chloro-N-(2-ethoxyethyl)-N-(2-methyl-1-phenylprop-1-enyl)acetamide |
