Introduction：Basic information about CAS 24063-28-3|4,5-dibromophthalic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,5-dibromophthalic acid |
|---|
| CAS Number | 24063-28-3 | Molecular Weight | 323.92300 |
|---|
| Density | 2.205g/cm3 | Boiling Point | 448ºC at 760 mmHg |
|---|
| Molecular Formula | C8H4Br2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 224.7ºC |
|---|
Names
| Name | 4,5-dibromophthalic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.205g/cm3 |
|---|
| Boiling Point | 448ºC at 760 mmHg |
|---|
| Molecular Formula | C8H4Br2O4 |
|---|
| Molecular Weight | 323.92300 |
|---|
| Flash Point | 224.7ºC |
|---|
| Exact Mass | 321.84800 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 2.60800 |
|---|
| Vapour Pressure | 8.23E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.679 |
|---|
| InChIKey | ZIRYHOLKTROMQO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(Br)c(Br)cc1C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4,5-dibromo-phthalic acid |
| 4,5-Dibrom-phthalsaeure |
| 4,5-dibromo-o-phthalic acid |
| I01-7855 |
| 4,5-dibromobenzene-1,2-dicarboxylic acid |
