Introduction:Basic information about CAS 52722-53-9|4-(2-PYRIDYLAZO)RESORCINOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2-PYRIDYLAZO)RESORCINOL |
|---|
| CAS Number | 52722-53-9 | Molecular Weight | 259.17200 |
|---|
| Density | / | Boiling Point | 438.2ºC at 760mmHg |
|---|
| Molecular Formula | C11H7N3Na2O2 | Melting Point | 188ºC |
|---|
| MSDS | / | Flash Point | 218.8ºC |
|---|
Names
| Name | 4-(2-pyridylazo)resorcinol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 438.2ºC at 760mmHg |
|---|
| Melting Point | 188ºC |
|---|
| Molecular Formula | C11H7N3Na2O2 |
|---|
| Molecular Weight | 259.17200 |
|---|
| Flash Point | 218.8ºC |
|---|
| Exact Mass | 259.03300 |
|---|
| PSA | 83.73000 |
|---|
| LogP | 3.78460 |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | PLPXLPIVACDMSI-UHFFFAOYSA-L |
|---|
| SMILES | [Na+].[Na+].[O-]c1ccc(N=Nc2ccccn2)c([O-])c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
Synonyms
| PAR |
| 3-benzenediol,4-(2-pyridinylazo)-disodiumsalt |
| 4-(2-pyridylazo)-1,3-bis(sodiooxy)benzene |
| MFCD00065369 |
| (2-PyridylAzo)ResorcinolDisodiumSalt |
| 4-(2-Pyridy |
| EINECS 258-131-6 |
| Disodium 4-(2-pyridinylazo)-1,3-benzenediolate |