Introduction：Basic information about CAS 74163-14-7|10H-Pyridazino[6,1-b]quinazoline-2-carboxylic acid, 7-methyl-10-oxo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 10H-Pyridazino[6,1-b]quinazoline-2-carboxylic acid, 7-methyl-10-oxo- |
|---|
| CAS Number | 74163-14-7 | Molecular Weight | 255.22900 |
|---|
| Density | 1.52g/cm3 | Boiling Point | 514.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 265.2ºC |
|---|
Names
| Name | 7-methyl-10-oxopyridazino[6,1-b]quinazoline-2-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.52g/cm3 |
|---|
| Boiling Point | 514.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9N3O3 |
|---|
| Molecular Weight | 255.22900 |
|---|
| Flash Point | 265.2ºC |
|---|
| Exact Mass | 255.06400 |
|---|
| PSA | 84.56000 |
|---|
| LogP | 1.24930 |
|---|
| Index of Refraction | 1.735 |
|---|
| InChIKey | PSXZNTKVVMANNS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc2c(=O)n3nc(C(=O)O)ccc3nc2c1 |
|---|
