Introduction：Basic information about CAS 603-23-6|2,4(1H,3H)-Quinazolinedione,3-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4(1H,3H)-Quinazolinedione,3-phenyl- |
|---|
| CAS Number | 603-23-6 | Molecular Weight | 238.24100 |
|---|
| Density | 1.319g/cm3 | Boiling Point | 447.6ºC at 760 mmHg |
|---|
| Molecular Formula | C14H10N2O2 | Melting Point | 281-283ºC |
|---|
| MSDS | / | Flash Point | 224.5ºC |
|---|
Names
| Name | 3-phenyl-1H-quinazoline-2,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.319g/cm3 |
|---|
| Boiling Point | 447.6ºC at 760 mmHg |
|---|
| Melting Point | 281-283ºC |
|---|
| Molecular Formula | C14H10N2O2 |
|---|
| Molecular Weight | 238.24100 |
|---|
| Flash Point | 224.5ºC |
|---|
| Exact Mass | 238.07400 |
|---|
| PSA | 54.86000 |
|---|
| LogP | 1.67900 |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | BHQNJNLXFVJFFI-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]c2ccccc2c(=O)n1-c1ccccc1 |
|---|
Safety Information
Synonyms
| 3-Phenyl-1,2,3,4-tetrahydroquinazoline-2,4-dione |
| 3-Phenylquinazoline-2,4-dione |
| 3-Phenyl-1H,3H-quinazoline-2,4-dione |
| 3-phenyl-2,4-dioxo-1,3-dihydroquinazoline |
| 2,4-dioxo-3-phenyl-1,2,3,4-tetrahydroquinazoline |
| 3-Phenyl-2,3H)-quinazolinedione |
