Introduction：Basic information about CAS 569-51-7|Benzene-1,2,3-tricarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene-1,2,3-tricarboxylic acid |
|---|
| CAS Number | 569-51-7 | Molecular Weight | 210.140 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 491.3±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6O6 | Melting Point | ~195 °C (dec.) |
|---|
| MSDS | / | Flash Point | 265.0±23.8 °C |
|---|
Names
| Name | Benzene-1,2,3-tricarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 491.3±40.0 °C at 760 mmHg |
|---|
| Melting Point | ~195 °C (dec.) |
|---|
| Molecular Formula | C9H6O6 |
|---|
| Molecular Weight | 210.140 |
|---|
| Flash Point | 265.0±23.8 °C |
|---|
| Exact Mass | 210.016434 |
|---|
| PSA | 111.90000 |
|---|
| LogP | -0.19 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | UJMDYLWCYJJYMO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc(C(=O)O)c1C(=O)O |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36-S37/39 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2917399090 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| HEMIMELLITIC ACID |
| EINECS 209-317-0 |
| benzenetricarboxylic acid |
| benzene-1,2,3-tricarboxylic acid |
| MFCD00002468 |
| 1,2,3-Benzenetricarboxylic acid |
| benzene tricarboxylic acid |
