Introduction:Basic information about CAS 175203-72-2|6-(Bromomethyl)-2-(trifluoromethyl)quinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-(Bromomethyl)-2-(trifluoromethyl)quinoline |
|---|
| CAS Number | 175203-72-2 | Molecular Weight | 290.07900 |
|---|
| Density | 1.613g/cm3 | Boiling Point | 311ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7BrF3N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 141.9ºC |
|---|
Names
| Name | 6-(Bromomethyl)-2-(trifluoromethyl)quinoline |
|---|
Chemical & Physical Properties
| Density | 1.613g/cm3 |
|---|
| Boiling Point | 311ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7BrF3N |
|---|
| Molecular Weight | 290.07900 |
|---|
| Flash Point | 141.9ºC |
|---|
| Exact Mass | 288.97100 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 4.14850 |
|---|
| Vapour Pressure | 0.00106mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | CWAOIBJOIADGIR-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc2cc(CBr)ccc2n1 |
|---|