Introduction：Basic information about CAS 105250-86-0|Ebiratide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ebiratide |
|---|
| CAS Number | 105250-86-0 | Molecular Weight | 996.22600 |
|---|
| Density | 1.258g/cm3 | Boiling Point | 1406.3ºC at 760mmHg |
|---|
| Molecular Formula | C48H73N11O10S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 804.3ºC |
|---|
Names
| Name | Ebiratide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.258g/cm3 |
|---|
| Boiling Point | 1406.3ºC at 760mmHg |
|---|
| Molecular Formula | C48H73N11O10S |
|---|
| Molecular Weight | 996.22600 |
|---|
| Flash Point | 804.3ºC |
|---|
| Exact Mass | 995.52600 |
|---|
| PSA | 361.16000 |
|---|
| LogP | 5.56000 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | CLFHFIGNDKHDPG-MPJXNKHJSA-N |
|---|
| SMILES | CS(=O)(=O)CCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(=O)NC(Cc1ccccc1)C(=O)NCCCCCCCCN |
|---|
Synonyms
| 4-(Methylsulfonyl)-L-Abu-L-Glu-L-His-L-Phe-D-Lys-L-Phe-(8-aminooctyl)NH2 |
| HOE-427 |
