Introduction：Basic information about CAS 103878-96-2|Fosopamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fosopamine |
|---|
| CAS Number | 103878-96-2 | Molecular Weight | 247.18500 |
|---|
| Density | 1.431g/cm3 | Boiling Point | 463.6ºC at 760mmHg |
|---|
| Molecular Formula | C9H14NO5P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 234.2ºC |
|---|
Names
| Name | [2-hydroxy-4-[2-(methylamino)ethyl]phenyl] dihydrogen phosphate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.431g/cm3 |
|---|
| Boiling Point | 463.6ºC at 760mmHg |
|---|
| Molecular Formula | C9H14NO5P |
|---|
| Molecular Weight | 247.18500 |
|---|
| Flash Point | 234.2ºC |
|---|
| Exact Mass | 247.06100 |
|---|
| PSA | 108.83000 |
|---|
| LogP | 1.01650 |
|---|
| Vapour Pressure | 2.15E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | WHEGQKBWPSOMHG-UHFFFAOYSA-N |
|---|
| SMILES | CNCCc1ccc(OP(=O)(O)O)c(O)c1 |
|---|
Synonyms
| Sim 2055 |
| UNII-50Q2Q042YR |
| Fosopamine |
| 2-hydroxy-4-[2-(methylamino)ethyl]phenyl dihydrogen phosphate |
| 4-(2-(Methylamino)ethyl)pyrocatechol 1-(dihydrogen phosphate) |
