Introduction：Basic information about CAS 93181-81-8|Lodaxaprine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Lodaxaprine |
|---|
| CAS Number | 93181-81-8 | Molecular Weight | 289.76000 |
|---|
| Density | 1.303g/cm3 | Boiling Point | 525.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16ClN3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 271.6ºC |
|---|
Names
| Name | 1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.303g/cm3 |
|---|
| Boiling Point | 525.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16ClN3O |
|---|
| Molecular Weight | 289.76000 |
|---|
| Flash Point | 271.6ºC |
|---|
| Exact Mass | 289.09800 |
|---|
| PSA | 49.25000 |
|---|
| LogP | 2.82310 |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | USEZRIFSJXAMJD-UHFFFAOYSA-N |
|---|
| SMILES | OC1CCN(c2ccc(-c3ccccc3Cl)nn2)CC1 |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Lodaxaprium |
| 3-(4-Hydroxypiperidino)-6-(4-chlorophenyl)pyridazine |
| Lodaxaprium [Latin] |
| 1-(6-(2-Chlorophenyl)-3-pyridazinyl)-4-piperidinol |
| 3-(4-hydroxy-piperidino)-6-(2-chlorophenyl)pyridazine |
| Lodaxaprina [Spanish] |
| 4-Piperidinol,1-(6-(2-chlorophenyl)-3-pyridazinyl) |
| Lodaxaprina |
| Lodaxaprine |
| 1-(6-(o-Chlorophenyl)-3-pyridazinyl)-4-piperidinol |
