Introduction：Basic information about CAS 90103-92-7|Zabiciprilat, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Zabiciprilat |
|---|
| CAS Number | 90103-92-7 | Molecular Weight | 388.45700 |
|---|
| Density | 1.273g/cm3 | Boiling Point | 632.2ºC at 760mmHg |
|---|
| Molecular Formula | C21H28N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 336.2ºC |
|---|
Names
| Name | (2S)-3-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]-3-azabicyclo[2.2.2]octane-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.273g/cm3 |
|---|
| Boiling Point | 632.2ºC at 760mmHg |
|---|
| Molecular Formula | C21H28N2O5 |
|---|
| Molecular Weight | 388.45700 |
|---|
| Flash Point | 336.2ºC |
|---|
| Exact Mass | 388.20000 |
|---|
| PSA | 106.94000 |
|---|
| LogP | 2.23350 |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | HBZJVGFXZTUXNI-XMQLQKOFSA-N |
|---|
| SMILES | CC(NC(CCc1ccccc1)C(=O)O)C(=O)N1C2CCC(CC2)C1C(=O)O |
|---|
Synonyms
| Zabiciprilate |
| Zabiciprilatum |
| Zabiciprilat |
| Zabiciprilatum [INN-Latin] |
| Zabiciprilate [INN-French] |
