Introduction:Basic information about CAS 4825-53-0|hexestrol dipropionate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | hexestrol dipropionate |
|---|
| CAS Number | 4825-53-0 | Molecular Weight | 382.49300 |
|---|
| Density | 1.066g/cm3 | Boiling Point | 469.5ºC at 760 mmHg |
|---|
| Molecular Formula | C24H30O4 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 225.8ºC |
|---|
| Symbol | GHS08 | Signal Word | Warning |
|---|
Names
| Name | [4-[4-(4-propanoyloxyphenyl)hexan-3-yl]phenyl] propanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.066g/cm3 |
|---|
| Boiling Point | 469.5ºC at 760 mmHg |
|---|
| Molecular Formula | C24H30O4 |
|---|
| Molecular Weight | 382.49300 |
|---|
| Flash Point | 225.8ºC |
|---|
| Exact Mass | 382.21400 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 6.00480 |
|---|
| Index of Refraction | 1.529 |
|---|
| InChIKey | HZLYMVNJKHJFRO-UHFFFAOYSA-N |
|---|
| SMILES | CCC(=O)Oc1ccc(C(CC)C(CC)c2ccc(OC(=O)CC)cc2)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol | GHS08 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H351 |
|---|
| Precautionary Statements | P281 |
|---|
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | 40 |
|---|
| Safety Phrases | 22-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| H8387_FLUKA |
| 4,4'-(1,2-diethyl-1,2-ethanediyl)bis-phenol |
| retalon oleosum |
| Hexestrol dipropionate |
| 3,4-Bis-(4-propionyloxy-phenyl)-hexan |
| 4,4'-(1,2-diethylethylene)diphenyl dipropionate |
| 3,4-bis-(4-propionyloxy-phenyl)-hexane |
| hexane-3,4-diyldibenzene-4,1-diyl dipropanoate |