Introduction：Basic information about CAS 69983-36-4|bis(4-methoxyphenyl)-dimethylsilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(4-methoxyphenyl)-dimethylsilane |
|---|
| CAS Number | 69983-36-4 | Molecular Weight | 272.41400 |
|---|
| Density | 1.03g/cm3 | Boiling Point | 340.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H20O2Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 126.3ºC |
|---|
Names
| Name | bis(4-methoxyphenyl)-dimethylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.03g/cm3 |
|---|
| Boiling Point | 340.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H20O2Si |
|---|
| Molecular Weight | 272.41400 |
|---|
| Flash Point | 126.3ºC |
|---|
| Exact Mass | 272.12300 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 2.52640 |
|---|
| Index of Refraction | 1.537 |
|---|
| InChIKey | OUGNJHFOQCLTPR-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc([Si](C)(C)c2ccc(OC)cc2)cc1 |
|---|
Synonyms
| Silane,bis(4-methoxyphenyl)dimethyl-(9CI) |
| Dimethyl-bis-(p-anisyl)-silan |
| AMTSi043 |
| Bis(4-methoxyphenyl)dimethylsilane |
| di(4-methoxyphenyl)dimethylsilane |
| Bis(4-methyoxyphenyl)dimethylsilane |
