Introduction：Basic information about CAS 948291-60-9|2,6-Dichloro-8-methylquinoline-3-carbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Dichloro-8-methylquinoline-3-carbonitrile |
|---|
| CAS Number | 948291-60-9 | Molecular Weight | 237.08500 |
|---|
| Density | 1.43g/cm3 | Boiling Point | 396.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H6Cl2N2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 193.8ºC |
|---|
| Symbol |
GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 2,6-Dichloro-8-methylquinoline-3-carbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Boiling Point | 396.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H6Cl2N2 |
|---|
| Molecular Weight | 237.08500 |
|---|
| Flash Point | 193.8ºC |
|---|
| Exact Mass | 235.99100 |
|---|
| PSA | 36.68000 |
|---|
| LogP | 3.72168 |
|---|
| Index of Refraction | 1.658 |
|---|
| InChIKey | PACCOJOKRQWVLY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Cl)cc2cc(C#N)c(Cl)nc12 |
|---|
Safety Information
| Symbol |
GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H318 |
|---|
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
|---|
| RIDADR | UN 2811 6.1 / PGIII |
|---|
