Introduction:Basic information about CAS 948294-51-7|2-Chloro-3-(2-chloroethyl)-6-ethylquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-3-(2-chloroethyl)-6-ethylquinoline |
|---|
| CAS Number | 948294-51-7 | Molecular Weight | 254.15500 |
|---|
| Density | 1.235g/cm3 | Boiling Point | 374.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13Cl2N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 212.1ºC |
|---|
Names
| Name | 2-Chloro-3-(2-chloroethyl)-6-ethylquinoline |
|---|
Chemical & Physical Properties
| Density | 1.235g/cm3 |
|---|
| Boiling Point | 374.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13Cl2N |
|---|
| Molecular Weight | 254.15500 |
|---|
| Flash Point | 212.1ºC |
|---|
| Exact Mass | 253.04300 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 4.23190 |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | TZQOXJSXWXQLAR-UHFFFAOYSA-N |
|---|
| SMILES | CCc1ccc2nc(Cl)c(CCCl)cc2c1 |
|---|