Introduction:Basic information about CAS 948294-56-2|2-Chloro-3-(2-chloroethyl)-7-fluoroquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-3-(2-chloroethyl)-7-fluoroquinoline |
|---|
| CAS Number | 948294-56-2 | Molecular Weight | 244.09200 |
|---|
| Density | 1.377g/cm3 | Boiling Point | 350.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8Cl2FN | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.8ºC |
|---|
Names
| Name | 2-Chloro-3-(2-chloroethyl)-7-fluoroquinoline |
|---|
Chemical & Physical Properties
| Density | 1.377g/cm3 |
|---|
| Boiling Point | 350.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8Cl2FN |
|---|
| Molecular Weight | 244.09200 |
|---|
| Flash Point | 165.8ºC |
|---|
| Exact Mass | 243.00200 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 3.80860 |
|---|
| Index of Refraction | 1.61 |
|---|
| InChIKey | FOEQLOJFXVXRPG-UHFFFAOYSA-N |
|---|
| SMILES | Fc1ccc2cc(CCCl)c(Cl)nc2c1 |
|---|