Introduction：Basic information about CAS 88728-27-2|2-Guanidino-3-phenylpropanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Guanidino-3-phenylpropanoic acid |
|---|
| CAS Number | 88728-27-2 | Molecular Weight | 207.22900 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 408.4ºC at 760 mmHg |
|---|
| Molecular Formula | C10H13N3O2 | Melting Point | 250ºC |
|---|
| MSDS | / | Flash Point | 200.8ºC |
|---|
Names
| Name | (S)-2-Guanidino-3-phenylpropionic acid, 95% |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 408.4ºC at 760 mmHg |
|---|
| Melting Point | 250ºC |
|---|
| Molecular Formula | C10H13N3O2 |
|---|
| Molecular Weight | 207.22900 |
|---|
| Flash Point | 200.8ºC |
|---|
| Exact Mass | 207.10100 |
|---|
| PSA | 99.20000 |
|---|
| LogP | 1.35630 |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | MVTHUEOHHHQQKY-UHFFFAOYSA-N |
|---|
| SMILES | NC(N)=NC(Cc1ccccc1)C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2925290090 |
|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| N-carbamimidoyl-phenylalanine |
| N-Formamidine-D,L-phenylalanine |
| amidinophenylalanine |
| N-Carbamimidoyl-phenylalanin |
| 2-Guanidino-3-phenylpropanoic acid |
