Introduction：Basic information about CAS 898289-61-7|2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]benzaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]benzaldehyde |
|---|
| CAS Number | 898289-61-7 | Molecular Weight | 254.20800 |
|---|
| Density | 1.3g/cm3 | Boiling Point | 359.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9F3N2O | Melting Point | 76.5-79.5ºC |
|---|
| MSDS | / | Flash Point | 171.1ºC |
|---|
Names
| Name | 2-[2-methyl-5-(trifluoromethyl)pyrazol-3-yl]benzaldehyde |
|---|
Chemical & Physical Properties
| Density | 1.3g/cm3 |
|---|
| Boiling Point | 359.3ºC at 760 mmHg |
|---|
| Melting Point | 76.5-79.5ºC |
|---|
| Molecular Formula | C12H9F3N2O |
|---|
| Molecular Weight | 254.20800 |
|---|
| Flash Point | 171.1ºC |
|---|
| Exact Mass | 254.06700 |
|---|
| PSA | 34.89000 |
|---|
| LogP | 2.91840 |
|---|
| Index of Refraction | 1.534 |
|---|
| InChIKey | STBRCNYURIXHAU-UHFFFAOYSA-N |
|---|
| SMILES | Cn1nc(C(F)(F)F)cc1-c1ccccc1C=O |
|---|
