Introduction：Basic information about CAS 60146-72-7|Di-o-tolyl Methylphosphonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Di-o-tolyl Methylphosphonate |
|---|
| CAS Number | 60146-72-7 | Molecular Weight | 276.26700 |
|---|
| Density | 1.158g/cm3 | Boiling Point | 378.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H17O3P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 196.5ºC |
|---|
Names
| Name | Di-o-tolyl Methylphosphonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.158g/cm3 |
|---|
| Boiling Point | 378.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H17O3P |
|---|
| Molecular Weight | 276.26700 |
|---|
| Flash Point | 196.5ºC |
|---|
| Exact Mass | 276.09200 |
|---|
| PSA | 45.34000 |
|---|
| LogP | 4.58410 |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | BMXNSAMZRSPALK-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccccc1OP(C)(=O)Oc1ccccc1C |
|---|
Synonyms
| Methyl-phosphonsaeure-di-o-tolylester |
| methyl-phosphonic acid di-o-tolyl ester |
| Di-o-methylphenylmethylphosphonat |
